Products 415712-97-9
CAS 415712-97-9 is the registry number for 3-[(4-Methylpiperidin-1-yl)sulfonyl]benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-(4-methylpiperidin-1-yl)sulfonylbenzoic acid (CAS 415712-97-9) is a chemical compound with the molecular formula C13H17NO4S and a molecular weight of 283.35 g/mol. IUPAC name: 3-(4-methylpiperidin-1-yl)sulfonylbenzoic acid. InChIKey: PFADICZLFNMCQX-UHFFFAOYSA-N.
| Molecular formula | C13H17NO4S |
|---|---|
| Molecular weight | 283.35 g/mol |
| IUPAC name | 3-(4-methylpiperidin-1-yl)sulfonylbenzoic acid |
| InChIKey | PFADICZLFNMCQX-UHFFFAOYSA-N |
| SMILES | CC1CCN(CC1)S(=O)(=O)C2=CC=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
3-((4-methylpiperidin-1-yl)sulfonyl)benzoic acid, benzoic acid, 3-[(4-methyl-1-piperidinyl)sulfonyl]-, 3-(4-methylpiperidin-1-yl)sulfonylbenzoic acid, Cambridge id 5348826, 3-(4-Methyl-piperidine-1-sulfonyl)-benzoic acid, Oprea1_122850, PFADICZLFNMCQX-UHFFFAOYSA-N, 3-[(4-methyl-1-piperidyl)sulfonyl]benzoic acid