CAS 577752-97-7 is the registry number for Methyl 4-(piperidine-1-sulfonyl)benzoate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 10g, 5g.
Methyl 4-piperidin-1-ylsulfonylbenzoate (CAS 577752-97-7) is a chemical compound with the molecular formula C13H17NO4S and a molecular weight of 283.35 g/mol. IUPAC name: methyl 4-piperidin-1-ylsulfonylbenzoate. InChIKey: MVAZFALZRCGBJG-UHFFFAOYSA-N.
| Molecular formula | C13H17NO4S |
|---|---|
| Molecular weight | 283.35 g/mol |
| IUPAC name | methyl 4-piperidin-1-ylsulfonylbenzoate |
| InChIKey | MVAZFALZRCGBJG-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)S(=O)(=O)N2CCCCC2 |
Computed by PubChem (NCBI)