CAS 326793-94-6 appears in our catalog under these names: Ramelteon Impurity 40, Ramelteon Impurity 14, N-(2-((8S)-1,6,7,8-Tetrahydro-2H-indeno(5,4-b)furan-8-yl)ethyl)acetamide. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
N-[2-[(8S)-2,6,7,8-tetrahydro-1H-cyclopenta[e][1]benzofuran-8-yl]ethyl]acetamide (CAS 326793-94-6) is a chemical compound with the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. IUPAC name: N-[2-[(8S)-2,6,7,8-tetrahydro-1H-cyclopenta[e][1]benzofuran-8-yl]ethyl]acetamide. InChIKey: SDSGISCYQWUIMI-LBPRGKRZSA-N.
| Molecular formula | C15H19NO2 |
|---|---|
| Molecular weight | 245.32 g/mol |
| IUPAC name | N-[2-[(8S)-2,6,7,8-tetrahydro-1H-cyclopenta[e][1]benzofuran-8-yl]ethyl]acetamide |
| InChIKey | SDSGISCYQWUIMI-LBPRGKRZSA-N |
| SMILES | CC(=O)NCC[C@@H]1CCC2=C1C3=C(C=C2)OCC3 |
Computed by PubChem (NCBI)