Products 326882-45-5

CAS 326882-45-5 is the registry number for Sulpiride Impurity 18. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

5-[(3-carboxyphenyl)sulfamoyl]-2-methoxybenzoic acid (CAS 326882-45-5) is a chemical compound with the molecular formula C15H13NO7S and a molecular weight of 351.3 g/mol. IUPAC name: 5-[(3-carboxyphenyl)sulfamoyl]-2-methoxybenzoic acid. InChIKey: ZEHAKLTWZCTNKN-UHFFFAOYSA-N.

Identity
Molecular formulaC15H13NO7S
Molecular weight351.3 g/mol
IUPAC name5-[(3-carboxyphenyl)sulfamoyl]-2-methoxybenzoic acid
InChIKeyZEHAKLTWZCTNKN-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C=C1)S(=O)(=O)NC2=CC=CC(=C2)C(=O)O)C(=O)O

Computed by PubChem (NCBI)