CAS 326882-45-5 is the registry number for Sulpiride Impurity 18. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
5-[(3-carboxyphenyl)sulfamoyl]-2-methoxybenzoic acid (CAS 326882-45-5) is a chemical compound with the molecular formula C15H13NO7S and a molecular weight of 351.3 g/mol. IUPAC name: 5-[(3-carboxyphenyl)sulfamoyl]-2-methoxybenzoic acid. InChIKey: ZEHAKLTWZCTNKN-UHFFFAOYSA-N.
| Molecular formula | C15H13NO7S |
|---|---|
| Molecular weight | 351.3 g/mol |
| IUPAC name | 5-[(3-carboxyphenyl)sulfamoyl]-2-methoxybenzoic acid |
| InChIKey | ZEHAKLTWZCTNKN-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)S(=O)(=O)NC2=CC=CC(=C2)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)