CAS 692261-49-7 is the registry number for 4-Formyl-2-methoxyphenyl 4-methyl-3-nitrobenzene-1-sulfonate, 95%. Offered by: AmBeed. Available pack sizes: 5g.
(4-formyl-2-methoxyphenyl) 4-methyl-3-nitrobenzenesulfonate (CAS 692261-49-7) is a chemical compound with the molecular formula C15H13NO7S and a molecular weight of 351.3 g/mol. IUPAC name: (4-formyl-2-methoxyphenyl) 4-methyl-3-nitrobenzenesulfonate. InChIKey: WKOKKJIBICKLCD-UHFFFAOYSA-N.
| Molecular formula | C15H13NO7S |
|---|---|
| Molecular weight | 351.3 g/mol |
| IUPAC name | (4-formyl-2-methoxyphenyl) 4-methyl-3-nitrobenzenesulfonate |
| InChIKey | WKOKKJIBICKLCD-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)S(=O)(=O)OC2=C(C=C(C=C2)C=O)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)