CAS 438031-81-3 appears in our catalog under these names: 2-Methyl-5-nitro-benzenesulfonic acid 4-formyl-2-methoxy-phenyl ester, 95%, 4-Formyl-2-methoxyphenyl 2-methyl-5-nitrobenzene-1-sulfonate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
(4-formyl-2-methoxyphenyl) 2-methyl-5-nitrobenzenesulfonate (CAS 438031-81-3) is a chemical compound with the molecular formula C15H13NO7S and a molecular weight of 351.3 g/mol. IUPAC name: (4-formyl-2-methoxyphenyl) 2-methyl-5-nitrobenzenesulfonate. InChIKey: FYMJPZKLZMQIDG-UHFFFAOYSA-N.
| Molecular formula | C15H13NO7S |
|---|---|
| Molecular weight | 351.3 g/mol |
| IUPAC name | (4-formyl-2-methoxyphenyl) 2-methyl-5-nitrobenzenesulfonate |
| InChIKey | FYMJPZKLZMQIDG-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)[N+](=O)[O-])S(=O)(=O)OC2=C(C=C(C=C2)C=O)OC |
Computed by PubChem (NCBI)