Products 327175-14-4

CAS 327175-14-4 is the registry number for 2C-G Hydrochloride. Offered by: TRC, Biosynth. Available pack sizes: 50mg, 5mg, 10mg, 25mg.

Structural formula: {0} (CAS {1})

2-(2,5-dimethoxy-3,4-dimethylphenyl)ethanamine;hydrochloride (CAS 327175-14-4) is a chemical compound with the molecular formula C12H20ClNO2 and a molecular weight of 245.74 g/mol. IUPAC name: 2-(2,5-dimethoxy-3,4-dimethylphenyl)ethanamine;hydrochloride. InChIKey: LSTJMRNIFGGQEH-UHFFFAOYSA-N.

Identity
Molecular formulaC12H20ClNO2
Molecular weight245.74 g/mol
IUPAC name2-(2,5-dimethoxy-3,4-dimethylphenyl)ethanamine;hydrochloride
InChIKeyLSTJMRNIFGGQEH-UHFFFAOYSA-N
SMILESCC1=C(C=C(C(=C1C)OC)CCN)OC.Cl

Computed by PubChem (NCBI)