CAS 32785-92-5 appears in our catalog under these names: 1-Deoxy-d-fructose, 95%, (3S,4R,5R)–3,4,5,6–tetrahydroxyhexan–2–one, 1-Deoxy-D-fructose, 97.00%, 1-Deoxy-D-fructose. Offered by: Combi-blocks, GLPBio, Chemat, Biosynth. Available pack sizes: 50mg, 10mg, 25mg, 100mg, 5mg, 2mg.
1-deoxy-L-fructose is the deoxy form of the rare sugar L-fructose.
Source: ChEBI
| Molecular formula | C6H12O5 |
|---|---|
| Molecular weight | 164.16 g/mol |
| IUPAC name | (3S,4R,5R)-3,4,5,6-tetrahydroxyhexan-2-one |
| InChIKey | IXDZFGATLNCIOI-HSUXUTPPSA-N |
| SMILES | CC(=O)[C@H]([C@@H]([C@@H](CO)O)O)O |
Computed by PubChem (NCBI)