CAS 328020-75-3 is the registry number for N-(2,3-Dimethylphenyl)-1,3-benzothiazol-2-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
N-(2,3-dimethylphenyl)-1,3-benzothiazol-2-amine (CAS 328020-75-3) is a chemical compound with the molecular formula C15H14N2S and a molecular weight of 254.4 g/mol. IUPAC name: N-(2,3-dimethylphenyl)-1,3-benzothiazol-2-amine. InChIKey: ZCMZHHNZRORCCO-UHFFFAOYSA-N.
| Molecular formula | C15H14N2S |
|---|---|
| Molecular weight | 254.4 g/mol |
| IUPAC name | N-(2,3-dimethylphenyl)-1,3-benzothiazol-2-amine |
| InChIKey | ZCMZHHNZRORCCO-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)NC2=NC3=CC=CC=C3S2)C |
Computed by PubChem (NCBI)