CAS 54708-13-3 is the registry number for N-(2,6-Dimethylphenyl)benzo(d)thiazol-2-amine, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g.
N-(2,6-dimethylphenyl)-1,3-benzothiazol-2-amine (CAS 54708-13-3) is a chemical compound with the molecular formula C15H14N2S and a molecular weight of 254.4 g/mol. IUPAC name: N-(2,6-dimethylphenyl)-1,3-benzothiazol-2-amine. InChIKey: BCQAXSNWOZRUNC-UHFFFAOYSA-N.
| Molecular formula | C15H14N2S |
|---|---|
| Molecular weight | 254.4 g/mol |
| IUPAC name | N-(2,6-dimethylphenyl)-1,3-benzothiazol-2-amine |
| InChIKey | BCQAXSNWOZRUNC-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)NC2=NC3=CC=CC=C3S2 |
Computed by PubChem (NCBI)