CAS 345621-77-4 appears in our catalog under these names: Benzyl-(4-methyl-benzothiazol-2-yl)-amine, 95%, N-Benzyl-4-methyl-1,3-benzothiazol-2-amine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g.
N-benzyl-4-methyl-1,3-benzothiazol-2-amine (CAS 345621-77-4) is a chemical compound with the molecular formula C15H14N2S and a molecular weight of 254.4 g/mol. IUPAC name: N-benzyl-4-methyl-1,3-benzothiazol-2-amine. InChIKey: PYSYVADBDWLFGZ-UHFFFAOYSA-N.
| Molecular formula | C15H14N2S |
|---|---|
| Molecular weight | 254.4 g/mol |
| IUPAC name | N-benzyl-4-methyl-1,3-benzothiazol-2-amine |
| InChIKey | PYSYVADBDWLFGZ-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)SC(=N2)NCC3=CC=CC=C3 |
Computed by PubChem (NCBI)