CAS 32943-25-2 appears in our catalog under these names: Clomipramine HCl EP Impurity F, Clomipramine EP Impurity F, 3-Chloroiminodibenzyl, >95% (HPLC), 3-Chloro-10,11-dihydro-5H-dibenzo(b,f)azepine, 3–Chloroiminodibenzyl. Offered by: Chemat Brand, TRC, Mikromol, GLPBio, TCI. Available pack sizes: on request, 250g, 25g, 5g, 25mg, 100mg, 100g, 10g.
2-chloro-6,11-dihydro-5H-benzo[b][1]benzazepine (CAS 32943-25-2) is a chemical compound with the molecular formula C14H12ClN and a molecular weight of 229.70 g/mol. IUPAC name: 2-chloro-6,11-dihydro-5H-benzo[b][1]benzazepine. InChIKey: MHUXTOYYIDFXRF-UHFFFAOYSA-N.
| Molecular formula | C14H12ClN |
|---|---|
| Molecular weight | 229.70 g/mol |
| IUPAC name | 2-chloro-6,11-dihydro-5H-benzo[b][1]benzazepine |
| InChIKey | MHUXTOYYIDFXRF-UHFFFAOYSA-N |
| SMILES | C1CC2=CC=CC=C2NC3=C1C=CC(=C3)Cl |
Computed by PubChem (NCBI)