Products 38093-12-8
CAS 38093-12-8 appears in our catalog under these names: Loratadine Impurity 53, Loratadine Impurity 34. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene (CAS 38093-12-8) is a chemical compound with the molecular formula C14H12ClN and a molecular weight of 229.70 g/mol. IUPAC name: 13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene. InChIKey: XGHDXNMFSJTSNK-UHFFFAOYSA-N.
| Molecular formula | C14H12ClN |
|---|---|
| Molecular weight | 229.70 g/mol |
| IUPAC name | 13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene |
| InChIKey | XGHDXNMFSJTSNK-UHFFFAOYSA-N |
| SMILES | C1CC2=C(CC3=C1C=CC=N3)C=CC(=C2)Cl |
Computed by PubChem (NCBI)