CAS 32953-89-2 is the registry number for Rimiterol. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[(R)-hydroxy-[(2S)-piperidin-2-yl]methyl]benzene-1,2-diol (CAS 32953-89-2) is a chemical compound with the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. IUPAC name: 4-[(R)-hydroxy-[(2S)-piperidin-2-yl]methyl]benzene-1,2-diol. InChIKey: IYMMESGOJVNCKV-JOYOIKCWSA-N.
| Molecular formula | C12H17NO3 |
|---|---|
| Molecular weight | 223.27 g/mol |
| IUPAC name | 4-[(R)-hydroxy-[(2S)-piperidin-2-yl]methyl]benzene-1,2-diol |
| InChIKey | IYMMESGOJVNCKV-JOYOIKCWSA-N |
| SMILES | C1CCN[C@@H](C1)[C@@H](C2=CC(=C(C=C2)O)O)O |
Computed by PubChem (NCBI)