Products 32990-41-3

CAS 32990-41-3 is the registry number for Tiaprofenic Acid Methyl Ester. Offered by: Mikromol. Available pack sizes: 100mg.

Structural formula: {0} (CAS {1})

Methyl 2-(5-benzoylthiophen-2-yl)propanoate (CAS 32990-41-3) is a chemical compound with the molecular formula C15H14O3S and a molecular weight of 274.3 g/mol. IUPAC name: methyl 2-(5-benzoylthiophen-2-yl)propanoate. InChIKey: LUVJXUXGNTWIHI-UHFFFAOYSA-N.

Identity
Molecular formulaC15H14O3S
Molecular weight274.3 g/mol
IUPAC namemethyl 2-(5-benzoylthiophen-2-yl)propanoate
InChIKeyLUVJXUXGNTWIHI-UHFFFAOYSA-N
SMILESCC(C1=CC=C(S1)C(=O)C2=CC=CC=C2)C(=O)OC

Computed by PubChem (NCBI)