CAS 32990-41-3 is the registry number for Tiaprofenic Acid Methyl Ester. Offered by: Mikromol. Available pack sizes: 100mg.
Methyl 2-(5-benzoylthiophen-2-yl)propanoate (CAS 32990-41-3) is a chemical compound with the molecular formula C15H14O3S and a molecular weight of 274.3 g/mol. IUPAC name: methyl 2-(5-benzoylthiophen-2-yl)propanoate. InChIKey: LUVJXUXGNTWIHI-UHFFFAOYSA-N.
| Molecular formula | C15H14O3S |
|---|---|
| Molecular weight | 274.3 g/mol |
| IUPAC name | methyl 2-(5-benzoylthiophen-2-yl)propanoate |
| InChIKey | LUVJXUXGNTWIHI-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=C(S1)C(=O)C2=CC=CC=C2)C(=O)OC |
Computed by PubChem (NCBI)