CAS 329938-59-2 is the registry number for 4-phenyl-1-((2,4,6-trimethylphenyl)sulfonyl)piperazine. Offered by: Biosynth. Available pack sizes: 250mg.
1-phenyl-4-(2,4,6-trimethylphenyl)sulfonylpiperazine (CAS 329938-59-2) is a chemical compound with the molecular formula C19H24N2O2S and a molecular weight of 344.5 g/mol. IUPAC name: 1-phenyl-4-(2,4,6-trimethylphenyl)sulfonylpiperazine. InChIKey: BVAYZVVKMGUPOB-UHFFFAOYSA-N.
| Molecular formula | C19H24N2O2S |
|---|---|
| Molecular weight | 344.5 g/mol |
| IUPAC name | 1-phenyl-4-(2,4,6-trimethylphenyl)sulfonylpiperazine |
| InChIKey | BVAYZVVKMGUPOB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)S(=O)(=O)N2CCN(CC2)C3=CC=CC=C3)C |
Computed by PubChem (NCBI)