CAS 33035-87-9 is the registry number for 3-(Dimethylamino)-1,2-dihydroisoquinolin-1-one, 95%. Offered by: AmBeed. Available pack sizes: 5g.
3-(dimethylamino)-2H-isoquinolin-1-one (CAS 33035-87-9) is a chemical compound with the molecular formula C11H12N2O and a molecular weight of 188.23 g/mol. IUPAC name: 3-(dimethylamino)-2H-isoquinolin-1-one. InChIKey: XMXNFXJQGSVAHW-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O |
|---|---|
| Molecular weight | 188.23 g/mol |
| IUPAC name | 3-(dimethylamino)-2H-isoquinolin-1-one |
| InChIKey | XMXNFXJQGSVAHW-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC2=CC=CC=C2C(=O)N1 |
Computed by PubChem (NCBI)