CAS 330555-87-8 appears in our catalog under these names: 7-Hydroxy-2,2-dimethyl-4H-benzo(d)(1,3)dioxin-4-one, 97%, 7-Hydroxy-2,2-dimethyl-4H-benzo[d][1,3]dioxin-4-one, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg.
7-hydroxy-2,2-dimethyl-1,3-benzodioxin-4-one (CAS 330555-87-8) is a chemical compound with the molecular formula C10H10O4 and a molecular weight of 194.18 g/mol. IUPAC name: 7-hydroxy-2,2-dimethyl-1,3-benzodioxin-4-one. InChIKey: IWILLXGWBMSIQW-UHFFFAOYSA-N.
| Molecular formula | C10H10O4 |
|---|---|
| Molecular weight | 194.18 g/mol |
| IUPAC name | 7-hydroxy-2,2-dimethyl-1,3-benzodioxin-4-one |
| InChIKey | IWILLXGWBMSIQW-UHFFFAOYSA-N |
| SMILES | CC1(OC2=C(C=CC(=C2)O)C(=O)O1)C |
Computed by PubChem (NCBI)