Products 33060-92-3
CAS 33060-92-3 is the registry number for (5-Fluoro-1H-1,3-benzodiazol-2-yl)(phenyl)methanol. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(6-fluoro-1H-benzimidazol-2-yl)-phenylmethanol (CAS 33060-92-3) is a chemical compound with the molecular formula C14H11FN2O and a molecular weight of 242.25 g/mol. IUPAC name: (6-fluoro-1H-benzimidazol-2-yl)-phenylmethanol. InChIKey: TXTJFLZJDDJOFR-UHFFFAOYSA-N.
| Molecular formula | C14H11FN2O |
|---|---|
| Molecular weight | 242.25 g/mol |
| IUPAC name | (6-fluoro-1H-benzimidazol-2-yl)-phenylmethanol |
| InChIKey | TXTJFLZJDDJOFR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=NC3=C(N2)C=C(C=C3)F)O |
Computed by PubChem (NCBI)