CAS 3308-24-5 is the registry number for 6-Phenylpyrimidine-2,4-diamine 98%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
6-phenylpyrimidine-2,4-diamine (CAS 3308-24-5) is a chemical compound with the molecular formula C10H10N4 and a molecular weight of 186.21 g/mol. IUPAC name: 6-phenylpyrimidine-2,4-diamine. InChIKey: ZISKLPYPMZTPOD-UHFFFAOYSA-N.
| Molecular formula | C10H10N4 |
|---|---|
| Molecular weight | 186.21 g/mol |
| IUPAC name | 6-phenylpyrimidine-2,4-diamine |
| InChIKey | ZISKLPYPMZTPOD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=NC(=N2)N)N |
Computed by PubChem (NCBI)