CAS 330945-09-0 appears in our catalog under these names: 1-(tert-Butyl) 2-methyl (2R,3R)-3-fluoropyrrolidine-1,2-dicarboxylate, 97%, O1-tert-butyl O2-methyl (2R,3R)-3-fluoropyrrolidine-1,2-dicarboxylate, 97%, 97%, O1-tert-butyl O2-methyl (2R,3R)-3-fluoropyrrolidine-1,2-dicarboxylate, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 500mg.
1-O-tert-butyl 2-O-methyl (2R,3R)-3-fluoropyrrolidine-1,2-dicarboxylate (CAS 330945-09-0) is a chemical compound with the molecular formula C11H18FNO4 and a molecular weight of 247.26 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (2R,3R)-3-fluoropyrrolidine-1,2-dicarboxylate. InChIKey: CHBKHXNHCHJSAP-SFYZADRCSA-N.
| Molecular formula | C11H18FNO4 |
|---|---|
| Molecular weight | 247.26 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl (2R,3R)-3-fluoropyrrolidine-1,2-dicarboxylate |
| InChIKey | CHBKHXNHCHJSAP-SFYZADRCSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H]([C@H]1C(=O)OC)F |
Computed by PubChem (NCBI)