CAS 33119-63-0 appears in our catalog under these names: 4,5-Diphenyl-oxazol-2-ylamine, 98%, 4,5-Diphenyloxazol-2-amine, 98%, 4,5-Diphenyl-oxazol-2-ylamine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
4,5-diphenyl-1,3-oxazol-2-amine (CAS 33119-63-0) is a chemical compound with the molecular formula C15H12N2O and a molecular weight of 236.27 g/mol. IUPAC name: 4,5-diphenyl-1,3-oxazol-2-amine. InChIKey: WRXUDNPJNMUPKL-UHFFFAOYSA-N.
| Molecular formula | C15H12N2O |
|---|---|
| Molecular weight | 236.27 g/mol |
| IUPAC name | 4,5-diphenyl-1,3-oxazol-2-amine |
| InChIKey | WRXUDNPJNMUPKL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(OC(=N2)N)C3=CC=CC=C3 |
Computed by PubChem (NCBI)