CAS 33119-71-0 is the registry number for 2-Amino-1-(4-tert-butylphenyl)ethan-1-one hydrochloride. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
2-amino-1-(4-tert-butylphenyl)ethanone;hydrochloride (CAS 33119-71-0) is a chemical compound with the molecular formula C12H18ClNO and a molecular weight of 227.73 g/mol. IUPAC name: 2-amino-1-(4-tert-butylphenyl)ethanone;hydrochloride. InChIKey: UELSSNHDPBUPHO-UHFFFAOYSA-N.
| Molecular formula | C12H18ClNO |
|---|---|
| Molecular weight | 227.73 g/mol |
| IUPAC name | 2-amino-1-(4-tert-butylphenyl)ethanone;hydrochloride |
| InChIKey | UELSSNHDPBUPHO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C(=O)CN.Cl |
Computed by PubChem (NCBI)