CAS 33143-28-1 is the registry number for 6-Nitro-2,2-dimethylchromene. Offered by: TRC. Available pack sizes: 5g.
2,2-dimethyl-6-nitrochromene (CAS 33143-28-1) is a chemical compound with the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. IUPAC name: 2,2-dimethyl-6-nitrochromene. InChIKey: MJVCBDKNZRGZDF-UHFFFAOYSA-N.
| Molecular formula | C11H11NO3 |
|---|---|
| Molecular weight | 205.21 g/mol |
| IUPAC name | 2,2-dimethyl-6-nitrochromene |
| InChIKey | MJVCBDKNZRGZDF-UHFFFAOYSA-N |
| SMILES | CC1(C=CC2=C(O1)C=CC(=C2)[N+](=O)[O-])C |
Computed by PubChem (NCBI)