Products 33173-27-2
CAS 33173-27-2 appears in our catalog under these names: (S)–2–Hydroxy–3–(4–nitrophenyl)propanoic acid, (S)-2-Hydroxy-3-(4-nitrophenyl)propanoic acid, 95%, (S)-2-Hydroxy-3-(4-nitrophenyl)propanoic acid, 95%, 95%. Offered by: GLPBio, Combi-blocks, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(2S)-2-hydroxy-3-(4-nitrophenyl)propanoic acid (CAS 33173-27-2) is a chemical compound with the molecular formula C9H9NO5 and a molecular weight of 211.17 g/mol. IUPAC name: (2S)-2-hydroxy-3-(4-nitrophenyl)propanoic acid. InChIKey: JUHYZGPSJIUDDU-QMMMGPOBSA-N.
| Molecular formula | C9H9NO5 |
|---|---|
| Molecular weight | 211.17 g/mol |
| IUPAC name | (2S)-2-hydroxy-3-(4-nitrophenyl)propanoic acid |
| InChIKey | JUHYZGPSJIUDDU-QMMMGPOBSA-N |
| SMILES | C1=CC(=CC=C1C[C@@H](C(=O)O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)