CAS 331749-96-3 is the registry number for Methyl n-(2,4-dimethoxyphenyl)-n-(phenylsulfonyl)glycinate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl 2-[N-(benzenesulfonyl)-2,4-dimethoxyanilino]acetate (CAS 331749-96-3) is a chemical compound with the molecular formula C17H19NO6S and a molecular weight of 365.4 g/mol. IUPAC name: methyl 2-[N-(benzenesulfonyl)-2,4-dimethoxyanilino]acetate. InChIKey: URUOEIWTYZDEJV-UHFFFAOYSA-N.
| Molecular formula | C17H19NO6S |
|---|---|
| Molecular weight | 365.4 g/mol |
| IUPAC name | methyl 2-[N-(benzenesulfonyl)-2,4-dimethoxyanilino]acetate |
| InChIKey | URUOEIWTYZDEJV-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)N(CC(=O)OC)S(=O)(=O)C2=CC=CC=C2)OC |
Computed by PubChem (NCBI)