CAS 380342-64-3 appears in our catalog under these names: (4-[(4-Ethoxy-benzenesulfonyl)-methyl-amino]-phenoxy)-acetic acid, 95%, 2-(4-(N-Methyl4-ethoxybenzenesulfonamido)phenoxy)acetic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100mg, 5g, 250mg, 10g.
2-[4-[(4-ethoxyphenyl)sulfonyl-methylamino]phenoxy]acetic acid (CAS 380342-64-3) is a chemical compound with the molecular formula C17H19NO6S and a molecular weight of 365.4 g/mol. IUPAC name: 2-[4-[(4-ethoxyphenyl)sulfonyl-methylamino]phenoxy]acetic acid. InChIKey: SADVAMHHRRGUNT-UHFFFAOYSA-N.
| Molecular formula | C17H19NO6S |
|---|---|
| Molecular weight | 365.4 g/mol |
| IUPAC name | 2-[4-[(4-ethoxyphenyl)sulfonyl-methylamino]phenoxy]acetic acid |
| InChIKey | SADVAMHHRRGUNT-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=C(C=C1)S(=O)(=O)N(C)C2=CC=C(C=C2)OCC(=O)O |
Computed by PubChem (NCBI)