Products 358765-87-4

CAS 358765-87-4 is the registry number for N-(3,4-Dimethoxyphenyl)-n-[(4-methylphenyl)sulfonyl]glycine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-(3,4-dimethoxy-N-(4-methylphenyl)sulfonylanilino)acetic acid (CAS 358765-87-4) is a chemical compound with the molecular formula C17H19NO6S and a molecular weight of 365.4 g/mol. IUPAC name: 2-(3,4-dimethoxy-N-(4-methylphenyl)sulfonylanilino)acetic acid. InChIKey: WKAFSGISDZPONF-UHFFFAOYSA-N.

Identity
Molecular formulaC17H19NO6S
Molecular weight365.4 g/mol
IUPAC name2-(3,4-dimethoxy-N-(4-methylphenyl)sulfonylanilino)acetic acid
InChIKeyWKAFSGISDZPONF-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)S(=O)(=O)N(CC(=O)O)C2=CC(=C(C=C2)OC)OC

Computed by PubChem (NCBI)