CAS 331847-02-0 is the registry number for (R)–3–Amino–4–(naphthalen–2–yl)butanoic acid hydrochloride. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.
(3R)-3-amino-4-naphthalen-2-ylbutanoic acid;hydrochloride (CAS 331847-02-0) is a chemical compound with the molecular formula C14H16ClNO2 and a molecular weight of 265.73 g/mol. IUPAC name: (3R)-3-amino-4-naphthalen-2-ylbutanoic acid;hydrochloride. InChIKey: BWSJJEOZKOCDCT-BTQNPOSSSA-N.
| Molecular formula | C14H16ClNO2 |
|---|---|
| Molecular weight | 265.73 g/mol |
| IUPAC name | (3R)-3-amino-4-naphthalen-2-ylbutanoic acid;hydrochloride |
| InChIKey | BWSJJEOZKOCDCT-BTQNPOSSSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)C[C@H](CC(=O)O)N.Cl |
Computed by PubChem (NCBI)