CAS 52263-88-4 is the registry number for Carprofen Methyl Ester. Offered by: Mikromol. Available pack sizes: 25mg.
Methyl 2-(6-chloro-9H-carbazol-2-yl)propanoate (CAS 52263-88-4) is a chemical compound with the molecular formula C16H14ClNO2 and a molecular weight of 287.74 g/mol. IUPAC name: methyl 2-(6-chloro-9H-carbazol-2-yl)propanoate. InChIKey: WGOODRXOEIQMQN-UHFFFAOYSA-N.
| Molecular formula | C16H14ClNO2 |
|---|---|
| Molecular weight | 287.74 g/mol |
| IUPAC name | methyl 2-(6-chloro-9H-carbazol-2-yl)propanoate |
| InChIKey | WGOODRXOEIQMQN-UHFFFAOYSA-N |
| SMILES | CC(C1=CC2=C(C=C1)C3=C(N2)C=CC(=C3)Cl)C(=O)OC |
Computed by PubChem (NCBI)