CAS 332061-86-6 appears in our catalog under these names: (S)-3-Amino-4-(3-cyanophenyl)butanoic acid hydrochloride, 98+%, (S)-3-Amino-4-(3-cyano-phenyl)-butyric acid hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
(3S)-3-amino-4-(3-cyanophenyl)butanoic acid;hydrochloride (CAS 332061-86-6) is a chemical compound with the molecular formula C11H13ClN2O2 and a molecular weight of 240.68 g/mol. IUPAC name: (3S)-3-amino-4-(3-cyanophenyl)butanoic acid;hydrochloride. InChIKey: NJAIOCXWQMXNIX-PPHPATTJSA-N.
| Molecular formula | C11H13ClN2O2 |
|---|---|
| Molecular weight | 240.68 g/mol |
| IUPAC name | (3S)-3-amino-4-(3-cyanophenyl)butanoic acid;hydrochloride |
| InChIKey | NJAIOCXWQMXNIX-PPHPATTJSA-N |
| SMILES | C1=CC(=CC(=C1)C#N)C[C@@H](CC(=O)O)N.Cl |
Computed by PubChem (NCBI)