CAS 33252-62-9 is the registry number for 2-Methoxy-5-methyl-3-nitropyridine, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.
2-methoxy-5-methyl-3-nitropyridine (CAS 33252-62-9) is a chemical compound with the molecular formula C7H8N2O3 and a molecular weight of 168.15 g/mol. IUPAC name: 2-methoxy-5-methyl-3-nitropyridine. InChIKey: QCQICELALGZQRL-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O3 |
|---|---|
| Molecular weight | 168.15 g/mol |
| IUPAC name | 2-methoxy-5-methyl-3-nitropyridine |
| InChIKey | QCQICELALGZQRL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N=C1)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)