Products 33322-63-3
CAS 33322-63-3 appears in our catalog under these names: 3-Cyano-N,N-dimethylbenzamide, 3-Cyano-N,N-dimethylbenzamide, 97%, 3-Cyano-N,N-dimethylbenzamide, 95%, 3-Cyano-N,N-dimethylbenzamide, 95%, 95%. Offered by: Biosynth, Combi-blocks, AmBeed, Fluorochem, Chemat. Available pack sizes: 5g, 0,5g, 1g, 10g, 250mg, 25g, 100mg.
3-cyano-N,N-dimethylbenzamide (CAS 33322-63-3) is a chemical compound with the molecular formula C10H10N2O and a molecular weight of 174.20 g/mol. IUPAC name: 3-cyano-N,N-dimethylbenzamide. InChIKey: CQUOVARNSKZJGM-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O |
|---|---|
| Molecular weight | 174.20 g/mol |
| IUPAC name | 3-cyano-N,N-dimethylbenzamide |
| InChIKey | CQUOVARNSKZJGM-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=CC=CC(=C1)C#N |
Computed by PubChem (NCBI)