CAS 33322-67-7 is the registry number for N,N-Dimethyl-(1,1'-biphenyl)-4-carboxamide, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g, 100g.
N,N-dimethyl-4-phenylbenzamide (CAS 33322-67-7) is a chemical compound with the molecular formula C15H15NO and a molecular weight of 225.28 g/mol. IUPAC name: N,N-dimethyl-4-phenylbenzamide. InChIKey: QNBIPRKUOSLWQE-UHFFFAOYSA-N.
| Molecular formula | C15H15NO |
|---|---|
| Molecular weight | 225.28 g/mol |
| IUPAC name | N,N-dimethyl-4-phenylbenzamide |
| InChIKey | QNBIPRKUOSLWQE-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=CC=C(C=C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)