CAS 333408-31-4 appears in our catalog under these names: (2-Chloro-8-methyl-3-quinolinyl)methanol, 95%, (2-Chloro-8-methylquinolin-3-yl)methanol, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg.
(2-chloro-8-methylquinolin-3-yl)methanol (CAS 333408-31-4) is a chemical compound with the molecular formula C11H10ClNO and a molecular weight of 207.65 g/mol. IUPAC name: (2-chloro-8-methylquinolin-3-yl)methanol. InChIKey: GQLHTRIZUUCKGQ-UHFFFAOYSA-N.
| Molecular formula | C11H10ClNO |
|---|---|
| Molecular weight | 207.65 g/mol |
| IUPAC name | (2-chloro-8-methylquinolin-3-yl)methanol |
| InChIKey | GQLHTRIZUUCKGQ-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C=C(C(=N2)Cl)CO |
Computed by PubChem (NCBI)