CAS 3336-18-3 appears in our catalog under these names: 2,5–Dichloro–4–hydroxybenzonitrile, 2,5-Dichloro-4-hydroxybenzonitrile 95%, 2,5-Dichloro-4-hydroxybenzonitrile, 95%, 95%, 2,5-DICHLORO-4-HYDROXYBENZONITRILE, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g.
2,5-dichloro-4-hydroxybenzonitrile (CAS 3336-18-3) is a chemical compound with the molecular formula C7H3Cl2NO and a molecular weight of 188.01 g/mol. IUPAC name: 2,5-dichloro-4-hydroxybenzonitrile. InChIKey: LIDUSYSXQFAHHK-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2NO |
|---|---|
| Molecular weight | 188.01 g/mol |
| IUPAC name | 2,5-dichloro-4-hydroxybenzonitrile |
| InChIKey | LIDUSYSXQFAHHK-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Cl)O)Cl)C#N |
Computed by PubChem (NCBI)