CAS 3336-32-1 appears in our catalog under these names: 3,5-Dichloro-2-hydroxybenzonitrile 97%, 3,5-Dichloro-2-hydroxybenzonitrile, 97%, 97%, 3,5-Dichloro-2-hydroxybenzonitrile, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g.
3,5-dichloro-2-hydroxybenzonitrile (CAS 3336-32-1) is a chemical compound with the molecular formula C7H3Cl2NO and a molecular weight of 188.01 g/mol. IUPAC name: 3,5-dichloro-2-hydroxybenzonitrile. InChIKey: ZTQVCIUXSLXAPV-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2NO |
|---|---|
| Molecular weight | 188.01 g/mol |
| IUPAC name | 3,5-dichloro-2-hydroxybenzonitrile |
| InChIKey | ZTQVCIUXSLXAPV-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C#N)O)Cl)Cl |
Computed by PubChem (NCBI)