CAS 334018-32-5 appears in our catalog under these names: 2-Chloro-4-isopropoxybenzoic acid, 98%, 2-Chloro-4-isopropoxybenzoic acid, 2-Chloro-4-isopropoxybenzoic acid, 96%, 96%, 2-Chloro-4-isopropoxybenzoic acid, 96%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg, 2,5g, 100mg, 500mg.
2-chloro-4-propan-2-yloxybenzoic acid (CAS 334018-32-5) is a chemical compound with the molecular formula C10H11ClO3 and a molecular weight of 214.64 g/mol. IUPAC name: 2-chloro-4-propan-2-yloxybenzoic acid. InChIKey: ACGZKCQTHXAZOX-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO3 |
|---|---|
| Molecular weight | 214.64 g/mol |
| IUPAC name | 2-chloro-4-propan-2-yloxybenzoic acid |
| InChIKey | ACGZKCQTHXAZOX-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=CC(=C(C=C1)C(=O)O)Cl |
Computed by PubChem (NCBI)