Products 3343-70-2
CAS 3343-70-2 is the registry number for D-Glucose-18O, 99.9%. Offered by: MedChemExpress. Available pack sizes: 1 mg, 25 mg, 5 mg, 10 mg.
(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexan(18O)al (CAS 3343-70-2) is a chemical compound with the molecular formula C6H12O6 and a molecular weight of 182.16 g/mol. IUPAC name: (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexan(18O)al. InChIKey: GZCGUPFRVQAUEE-WHMSQDSOSA-N.
| Molecular formula | C6H12O6 |
|---|---|
| Molecular weight | 182.16 g/mol |
| IUPAC name | (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexan(18O)al |
| InChIKey | GZCGUPFRVQAUEE-WHMSQDSOSA-N |
| SMILES | C([C@H]([C@H]([C@@H]([C@H](C=[18O])O)O)O)O)O |
Computed by PubChem (NCBI)