CAS 334477-68-8 appears in our catalog under these names: 3-(4-Fluoro-2-methylphenyl)piperazin-2-one, 95%, 3-(4-Fluoro-2-methylphenyl)piperazin-2-one, 98+%, 3-(4-Fluoro-2-methylphenyl)piperazin-2-one. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 0,1g, 0,05g, 0,25g, 0,5g.
3-(4-fluoro-2-methylphenyl)piperazin-2-one (CAS 334477-68-8) is a chemical compound with the molecular formula C11H13FN2O and a molecular weight of 208.23 g/mol. IUPAC name: 3-(4-fluoro-2-methylphenyl)piperazin-2-one. InChIKey: DFUGUOHNKOIDMN-UHFFFAOYSA-N.
| Molecular formula | C11H13FN2O |
|---|---|
| Molecular weight | 208.23 g/mol |
| IUPAC name | 3-(4-fluoro-2-methylphenyl)piperazin-2-one |
| InChIKey | DFUGUOHNKOIDMN-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)F)C2C(=O)NCCN2 |
Computed by PubChem (NCBI)