CAS 334792-76-6 appears in our catalog under these names: Ethyl 3–bromo–2–fluorobenzoate, Ethyl 3-bromo-2-fluorobenzoate 98%, Ethyl 3-bromo-2-fluorobenzoate, 98%, 98%, Ethyl 3-bromo-2-fluorobenzoate, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 50g, 250g, 100mg, 25g.
Ethyl 3-bromo-2-fluorobenzoate (CAS 334792-76-6) is a chemical compound with the molecular formula C9H8BrFO2 and a molecular weight of 247.06 g/mol. IUPAC name: ethyl 3-bromo-2-fluorobenzoate. InChIKey: GQNWAVFXHZEZKP-UHFFFAOYSA-N.
| Molecular formula | C9H8BrFO2 |
|---|---|
| Molecular weight | 247.06 g/mol |
| IUPAC name | ethyl 3-bromo-2-fluorobenzoate |
| InChIKey | GQNWAVFXHZEZKP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=CC=C1)Br)F |
Computed by PubChem (NCBI)