CAS 334829-57-1 is the registry number for 5-Bromo-1-ethyl-1,3-dihydro-benzoimidazol-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
6-bromo-3-ethyl-1H-benzimidazol-2-one (CAS 334829-57-1) is a chemical compound with the molecular formula C9H9BrN2O and a molecular weight of 241.08 g/mol. IUPAC name: 6-bromo-3-ethyl-1H-benzimidazol-2-one. InChIKey: VIGNKCSOIIWEBP-UHFFFAOYSA-N.
| Molecular formula | C9H9BrN2O |
|---|---|
| Molecular weight | 241.08 g/mol |
| IUPAC name | 6-bromo-3-ethyl-1H-benzimidazol-2-one |
| InChIKey | VIGNKCSOIIWEBP-UHFFFAOYSA-N |
| SMILES | CCN1C2=C(C=C(C=C2)Br)NC1=O |
Computed by PubChem (NCBI)