Products 33499-42-2
CAS 33499-42-2 appears in our catalog under these names: Ethyl 2,4–dimethylbenzoate, Ethyl 2,4-dimethylbenzoate, Ethyl 2,4-Dimethylbenzoate, 98%, 98%, Ethyl 2,4-dimethylbenzoate, min. 95 %, 5 g, Ethyl 2,4-dimethylbenzoate, min. 95 %, 10 g. Offered by: GLPBio, Biosynth, Chemat, Roth, Fluorochem. Available pack sizes: 100g, 25g, 5g, 10g, 1g.
Ethyl 2,4-dimethylbenzoate (CAS 33499-42-2) is a chemical compound with the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. IUPAC name: ethyl 2,4-dimethylbenzoate. InChIKey: RJYPOWRKMKNFHH-UHFFFAOYSA-N.
| Molecular formula | C11H14O2 |
|---|---|
| Molecular weight | 178.23 g/mol |
| IUPAC name | ethyl 2,4-dimethylbenzoate |
| InChIKey | RJYPOWRKMKNFHH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=C(C=C1)C)C |
Computed by PubChem (NCBI)