Products 33499-43-3
CAS 33499-43-3 appears in our catalog under these names: Ethyl 2,5-dimethylbenzoate, 95%, Ethyl 2,5-dimethylbenzoate, 97%, Ethyl 2,5-dimethylbenzoate, Ethyl 2,5-dimethylbenzoate, 97%, 97%, Ethyl 2,5-dimethylbenzoate, min. 95 %, 25 g. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Roth. Available pack sizes: 1g, 100g, 25g, 5g, 50g.
Ethyl 2,5-dimethylbenzoate (CAS 33499-43-3) is a chemical compound with the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. IUPAC name: ethyl 2,5-dimethylbenzoate. InChIKey: DDZFMOLFXZLMPP-UHFFFAOYSA-N.
| Molecular formula | C11H14O2 |
|---|---|
| Molecular weight | 178.23 g/mol |
| IUPAC name | ethyl 2,5-dimethylbenzoate |
| InChIKey | DDZFMOLFXZLMPP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=CC(=C1)C)C |
Computed by PubChem (NCBI)
Synonyms:
2,5-Dimethylbenzoic acid ethyl ester