CAS 335081-12-4 appears in our catalog under these names: 4,6-Dichloro-1,3-dinitrobenzene-13C6, 99 atom % 13C, min 98% Chemical Purity, 1,5-Dichloro-2,4-dinitrobenzene-13C6, 99%. Offered by: CDN, MedChemExpress. Available pack sizes: 0,1g, 5 mg, 10 mg, 1 mg.
1,5-dichloro-2,4-dinitro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene (CAS 335081-12-4) is a chemical compound with the molecular formula C6H2Cl2N2O4 and a molecular weight of 242.95 g/mol. IUPAC name: 1,5-dichloro-2,4-dinitro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene. InChIKey: ZPXDNSYFDIHPOJ-IDEBNGHGSA-N.
| Molecular formula | C6H2Cl2N2O4 |
|---|---|
| Molecular weight | 242.95 g/mol |
| IUPAC name | 1,5-dichloro-2,4-dinitro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene |
| InChIKey | ZPXDNSYFDIHPOJ-IDEBNGHGSA-N |
| SMILES | [13CH]1=[13C]([13C](=[13CH][13C](=[13C]1[N+](=O)[O-])Cl)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)