CAS 336182-29-7 appears in our catalog under these names: N-Isopropyl 4-bromobenzamide, 98%, 4–Bromo–N–isopropylbenzamide, N-Isopropyl 4-bromobenzamide, 97%, 97%, 4-Bromo-N-isopropylbenzamide, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 10g, 100g, 5g, 250mg, 100mg.
4-bromo-N-propan-2-ylbenzamide (CAS 336182-29-7) is a chemical compound with the molecular formula C10H12BrNO and a molecular weight of 242.11 g/mol. IUPAC name: 4-bromo-N-propan-2-ylbenzamide. InChIKey: PWXNCWKINUCUPV-UHFFFAOYSA-N.
| Molecular formula | C10H12BrNO |
|---|---|
| Molecular weight | 242.11 g/mol |
| IUPAC name | 4-bromo-N-propan-2-ylbenzamide |
| InChIKey | PWXNCWKINUCUPV-UHFFFAOYSA-N |
| SMILES | CC(C)NC(=O)C1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)