CAS 33621-24-8 appears in our catalog under these names: ([5-(2-Furyl)-1,3,4-oxadiazol-2-yl]thio)acetic acid, 95%, 2-((5-(Furan-2-yl)-1,3,4-oxadiazol-2-yl)thio)acetic acid, 98%, {(5–(2–furyl)–1,3,4–oxadiazol–2–yl)thio}acetic acid, 2-{(5-(Furan-2-yl)-1,3,4-oxadiazol-2-yl)sulfanyl}acetic acid, 2-{[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]sulfanyl}acetic acid, 98%, 98%. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, Chemat. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 500mg, 0,5g, 50mg.
2-[[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetic acid (CAS 33621-24-8) is a chemical compound with the molecular formula C8H6N2O4S and a molecular weight of 226.21 g/mol. IUPAC name: 2-[[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetic acid. InChIKey: WMMOVVYXIVGNHJ-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O4S |
|---|---|
| Molecular weight | 226.21 g/mol |
| IUPAC name | 2-[[5-(furan-2-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetic acid |
| InChIKey | WMMOVVYXIVGNHJ-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C2=NN=C(O2)SCC(=O)O |
Computed by PubChem (NCBI)