Products 869464-87-9

CAS 869464-87-9 is the registry number for 2-(2-Oxo-5-(thiophen-2-yl)-2,3-dihydro-1,3,4-oxadiazol-3-yl)acetic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.

Structural formula: {0} (CAS {1})

2-(2-oxo-5-thiophen-2-yl-1,3,4-oxadiazol-3-yl)acetic acid (CAS 869464-87-9) is a chemical compound with the molecular formula C8H6N2O4S and a molecular weight of 226.21 g/mol. IUPAC name: 2-(2-oxo-5-thiophen-2-yl-1,3,4-oxadiazol-3-yl)acetic acid. InChIKey: ZTKUPPLGYYWWIJ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6N2O4S
Molecular weight226.21 g/mol
IUPAC name2-(2-oxo-5-thiophen-2-yl-1,3,4-oxadiazol-3-yl)acetic acid
InChIKeyZTKUPPLGYYWWIJ-UHFFFAOYSA-N
SMILESC1=CSC(=C1)C2=NN(C(=O)O2)CC(=O)O

Computed by PubChem (NCBI)