Products 674773-14-9
CAS 674773-14-9 appears in our catalog under these names: 5-Amino-2-carboxy-4-cyano-3-thiopheneacetic Acid, >95% (HPLC), 5-Amino-2-carboxy-4-cyano-3-thiopheneacetic acid. Offered by: TRC, Biosynth. Available pack sizes: 10mg, 2,5mg, 25mg, 250mg, 500mg.
5-amino-3-(carboxymethyl)-4-cyanothiophene-2-carboxylic acid (CAS 674773-14-9) is a chemical compound with the molecular formula C8H6N2O4S and a molecular weight of 226.21 g/mol. IUPAC name: 5-amino-3-(carboxymethyl)-4-cyanothiophene-2-carboxylic acid. InChIKey: KNPBNTMMZCNVIE-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O4S |
|---|---|
| Molecular weight | 226.21 g/mol |
| IUPAC name | 5-amino-3-(carboxymethyl)-4-cyanothiophene-2-carboxylic acid |
| InChIKey | KNPBNTMMZCNVIE-UHFFFAOYSA-N |
| SMILES | C(C1=C(SC(=C1C#N)N)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)