CAS 33628-84-1 appears in our catalog under these names: Methyl Z-L-Alaninamide, 95%, Methyl Z–L–Alaninamide. Offered by: AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 5g.
Benzyl N-[(2S)-1-(methylamino)-1-oxopropan-2-yl]carbamate (CAS 33628-84-1) is a chemical compound with the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. IUPAC name: benzyl N-[(2S)-1-(methylamino)-1-oxopropan-2-yl]carbamate. InChIKey: OGLOMKXQVPOBEP-VIFPVBQESA-N.
| Molecular formula | C12H16N2O3 |
|---|---|
| Molecular weight | 236.27 g/mol |
| IUPAC name | benzyl N-[(2S)-1-(methylamino)-1-oxopropan-2-yl]carbamate |
| InChIKey | OGLOMKXQVPOBEP-VIFPVBQESA-N |
| SMILES | C[C@@H](C(=O)NC)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)